![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - Kill The Poor.mp3 | 2007-12-06 04:53 | 5.6M | |
| 02 - Forward To Death.mp3 | 2007-12-06 04:53 | 2.5M | |
| 03 - When Ya Get Drafted.mp3 | 2007-12-06 04:53 | 2.5M | |
| 04 - Let's Lynch The Landlord.mp3 | 2007-12-06 04:53 | 4.0M | |
| 05 - Drug Me.mp3 | 2007-12-06 04:53 | 3.5M | |
| 06 - Your Emotions.mp3 | 2007-12-06 04:53 | 2.4M | |
| 07 - Chemical Warfare.mp3 | 2007-12-06 04:53 | 5.3M | |
| 08 - California Über Alles.mp3 | 2007-12-06 04:53 | 5.5M | |
| 09 - I Kill Children.mp3 | 2007-12-06 04:53 | 3.7M | |
| 10 - Stealing People's Mail.mp3 | 2007-12-06 04:53 | 2.8M | |
| 11 - Funland At The Beach.mp3 | 2007-12-06 04:53 | 3.3M | |
| 12 - Ill In The Head.mp3 | 2007-12-06 04:53 | 5.0M | |
| 14 - Viva Las Vegas.mp3 | 2007-12-06 04:53 | 4.8M | |
| AlbumArtSmall.jpg | 2007-11-21 01:49 | 2.3K | |
| AlbumArt_{C60A5BB4-F237-4CE6-8B71-5D97BBBDF824}_Large.jpg | 2007-11-21 01:49 | 8.2K | |
| AlbumArt_{C60A5BB4-F237-4CE6-8B71-5D97BBBDF824}_Small.jpg | 2007-11-21 01:49 | 2.3K | |
| Folder.jpg | 2007-11-21 01:49 | 8.2K | |
| desktop.ini | 2007-11-21 01:50 | 412 | |